On Target TRY1_HUMAN 0.45833334/CHEMBL327113
For the given ligand Primidone, we have found in our database that, being scored 0.45833334, the most similar ligand is CHEMBL327113. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL327113 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CC[C@H](C(=O)N1CCC[C@H]1C(=O)NC(C=O)CCCN=C(N)N)c1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00010000 01003000 00100100 04010e00 00000002 00000010 00010000 20000008 00200880 000808c2 08300010 4003b000 07008012 00002009 c0000000 00000000 00000800 02000000 00000000 00000201 00000100 38240620 00000001 83500018 00000000 80000000 40010000 10000000 0c000000 00060003 20006000 00002600 |