On Target 5HT1B_HUMAN 0.4054054/CHEMBL350277
For the given ligand Primidone, we have found in our database that, being scored 0.4054054, the most similar ligand is CHEMBL350277. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL350277 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CN(C)[C@H]1C[C@H](c2c[nH]c3ccc(CC(=O)NCc4ccccc4)cc32)C1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00000002 01804a00 00100102 40810610 00041300 00000000 00002000 02001000 00400980 000808c0 08300004 40009800 09008802 00600810 40000440 00040004 00000000 02000004 00200400 00000201 c0000100 18208608 20800000 81400018 00042000 c0000000 08000040 90000000 04400100 0006000b 20042200 00000620 |