On Target NTRK1_HUMAN 0.29464287/CHEMBL4521353
For the given ligand Primidone, we have found in our database that, being scored 0.29464287, the most similar ligand is CHEMBL4521353. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL4521353 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CC(C)(C)C(=O)N1N=CC[C@H]1c1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00800004 00e01000 00100100 20011e00 00400000 00000000 00000001 03005002 08000800 00080841 08310008 40009004 00008802 00000008 00000400 00000004 02000000 02001000 80000400 00000a01 80080100 18008600 40000000 00400018 00200000 c0400083 40000000 80000000 00000100 00cf0403 20040000 00002680 |