On Target OPRX_HUMAN 0.56578946/CHEMBL271322
For the given ligand Primidone, we have found in our database that, being scored 0.56578946, the most similar ligand is CHEMBL271322. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL271322 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CNC(=O)C1(c2ccccc2)CCN(C2CCC(C(C)C)CC2)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00020000 01000200 00100100 00010600 00000000 00000000 00000000 20000000 00200800 000808c0 08300000 50039000 05008002 00000000 40000000 00040000 00000000 02000000 02002000 00000201 00000100 18200610 00000000 81500010 00000000 80000000 00000000 10000000 04000000 0006000b 00022000 00802600 |