On Target IKKB_HUMAN 0.34351146/CHEMBL3823257
For the given ligand Primidone, we have found in our database that, being scored 0.34351146, the most similar ligand is CHEMBL3823257. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3823257 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | C=C(CC1(O)C(=O)Nc2ccccc21)C(=O)OC |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 00054002 01000000 00101112 00010700 20280080 00006000 01000000 00000400 11000900 001a08c2 083800a4 4001d000 05008030 01300000 40020144 00080008 0086c000 02000000 18400018 00000001 40100100 18200e20 23002000 81500011 00000000 80000200 08000010 90001080 04008200 80060003 44002080 20410610 |