On Target MK03_HUMAN 0.3539823/CHEMBL3113587
For the given ligand Primidone, we have found in our database that, being scored 0.3539823, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| Primidone (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| CCC2(c1ccccc1)C(=O)NCNC2=O | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc1ccccc1 |
|
|
|
|
|
|
| 00000000 01000000 00100100 00010e00 00000000 00000000 00000004 00002000 00000900 000809c0 08300000 40009000 0d009000 00000000 40000000 00000000 00000008 02000000 00000010 00000001 00000100 18210600 00000000 81400010 00012000 80000000 00000000 10000000 04000000 00060213 00082000 00000600 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |