On Target NMDZ1_HUMAN 0.192/CHEMBL419399
For the given ligand mescaline, we have found in our database that, being scored 0.192, the most similar ligand is CHEMBL419399. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL419399 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | Cc1ccc(CC2CCN(CC#Cc3ccc4[nH]c(O)nc4c3)CC2)cc1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000202 01020810 00120902 040d0600 00442040 00004000 00000000 20100020 00100900 000808c0 09308004 50018800 00000002 00600000 60100140 000c000c 00000000 02000024 00200000 00000201 40020100 18900020 21890001 02500010 00000084 80000000 00000240 10000000 03400000 00460002 40000020 040006a0 |