On Target PDE5A_HUMAN 0.33944955/CHEMBL363889
For the given ligand mescaline, we have found in our database that, being scored 0.33944955, the most similar ligand is CHEMBL363889. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL363889 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | CCc1cc(C(C)=O)c(O)cc1OCc1cccc(C(=O)NCC(=O)O)c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04008009 00004808 20000109 00010600 00001081 80024000 52040000 02001200 00000100 00080a40 48200000 4000a000 02808802 00010000 01000401 0a082008 10000000 02008000 00000000 40020800 00000000 08028e20 02000000 00c0101c 00004000 c0002000 08120000 80800000 00010300 00060003 e0044004 00000600 |