On Target FABP5_HUMAN 0.37373737/CHEMBL212860
For the given ligand mescaline, we have found in our database that, being scored 0.37373737, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | O=C(O)Cc1cccc(OCc2ccccc2Cl)c1OCc1ccccc1Cl |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |