On Target PAR1_HUMAN 0.33620688/CHEMBL2370948
For the given ligand mescaline, we have found in our database that, being scored 0.33620688, the most similar ligand is CHEMBL2370948. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL2370948 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)cc1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00010000 01003208 20100108 04010e00 00001002 00000000 02050000 2000000c 00200880 000808c2 08300010 4003b000 16008012 00002009 81000001 000c0008 00000800 02000000 00800008 00020201 00000100 38240620 03000083 83500018 00000801 80000000 40130000 10000000 0c000200 0006000b 20004000 00002600 |