On Target AMPN_HUMAN 0.46341464/CHEMBL3806197
For the given ligand mescaline, we have found in our database that, being scored 0.46341464, the most similar ligand is CHEMBL3806197. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL3806197 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(CCNCC(N)P(=O)(O)O)cc1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000400 00000608 20100108 00010620 00001000 00000000 02040000 00000000 00000080 00080840 08200000 40008000 00000002 00020000 01000001 00000008 00000028 02000000 40000000 00020200 00000000 3d300000 00800001 83400010 00002002 80000000 00120000 00014000 0c080200 00060002 20800000 00008623 |