On Target AOFA_HUMAN 0.5205479/CHEMBL3415801
For the given ligand mescaline, we have found in our database that, being scored 0.5205479, the most similar ligand is CHEMBL3415801. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL3415801 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | C#CCN(C)CC(=C)c1ccc(OC)cc1.Cl |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000000 00000008 20100108 00010600 00403000 00000000 82040080 00100400 00000080 00080840 08200000 40008000 00000002 00010000 01100001 00000008 00000000 02000100 00000000 00020200 00000000 18200000 00010001 81400010 00000000 80000000 001a2000 00020000 04400200 00060002 04000020 00020600 |