On Target PDE4B_HUMAN 0.52272725/CHEMBL36724
For the given ligand mescaline, we have found in our database that, being scored 0.52272725, the most similar ligand is CHEMBL36724. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL36724 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(C2CCN(C#N)C2)cc1OC1CCCC1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04000000 43000208 20100108 00210700 00081040 c2000010 02040000 00000000 00000880 010808c0 08300000 40008000 00804002 20000080 11000001 020ca008 08800000 02000000 01480000 00020201 00000100 18200000 01000400 81400010 00000000 80000000 00120000 10000000 04000200 0106080a 00000000 00000640 |