On Target BACE1_HUMAN 0.4090909/CHEMBL2298980
For the given ligand mescaline, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL2298980. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL2298980 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc(C(=O)/C=C/c2ccc(N(Cc3ccccc3)Cc3ccccc3)cc2)cc(OC)c1OC |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00004003 42000c08 20000309 00010600 00001000 00800000 c2040081 02001400 01800000 00b80840 08200004 4000c000 0000c802 20008000 01004443 20008008 00042400 02100004 08098000 00020a00 40100000 08028200 20018000 00400014 01000000 c0000000 00522000 c0000080 00408300 0006000a 84040000 00002600 |