On Target NEP_HUMAN 0.4368932/CHEMBL11806
For the given ligand mescaline, we have found in our database that, being scored 0.4368932, the most similar ligand is CHEMBL11806. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL11806 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(C(C)C(CS)C(=O)NC(Cc2ccc(O)cc2)C(=O)O)cc1OC |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000000 42005208 20100108 00110600 00001080 40000000 02040000 20000004 00000880 000808c0 08300000 4000b000 0600c002 20040000 81080001 000c8008 10000000 02000000 00480008 00420201 60000100 18200e00 03000340 81400018 00000800 80000000 00120000 10000000 04000200 0006003b 20004000 01012600 |