On Target ALDR_HUMAN 0.41573033/CHEMBL114289
For the given ligand mescaline, we have found in our database that, being scored 0.41573033, the most similar ligand is CHEMBL114289. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL114289 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1c(-c2c(C)cc3c(C(C)C)c(O)c(O)c(C=O)c3c2OC)c(C)cc2c(C(C)C)c(O)c(O)c(C=O)c12 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00002000 42000809 20000108 40010200 00001001 28020000 02040000 00002200 00000100 00080840 08000000 40008800 00008002 00200000 21004001 2000a008 00020000 82000000 04080000 10220a00 00000000 08020208 10000000 00404054 00000000 80000000 101a0000 00000040 00004300 10020002 80000200 02000400 |