On Target AA1R_HUMAN 0.42391303/CHEMBL1544
For the given ligand mescaline, we have found in our database that, being scored 0.42391303, the most similar ligand is CHEMBL1544. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL1544 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 |