On Target TRPM4_HUMAN 0.21311475/CHEMBL1408302
For the given ligand mescaline, we have found in our database that, being scored 0.21311475, the most similar ligand is CHEMBL1408302. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL1408302 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | O=C(COc1cccc2ccccc12)Nc1cc(Cl)ccc1C(=O)O |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 1401e002 00000808 20001108 01010602 00001080 00014040 0a000000 00080100 00800100 00080840 002c0084 4000d800 06808086 00100001 01021041 00080008 00040000 82000000 08000000 00024000 40100000 08060f28 32002000 00400004 00002000 80000000 08040018 00001080 00008200 00060001 c0000000 00020200 |