On Target PGH1_SHEEP 0.44444445/CHEMBL12952
For the given ligand mescaline, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL12952. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL12952 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc2cc(C(C)C(=O)O)ccc2c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000000 00000008 20000108 00010200 00001040 00000000 02000000 00000000 00000000 00080840 08000000 40009000 01008002 00000000 41040001 00080008 08000000 02000000 00000000 00020000 00000000 08000a08 01000000 00400010 00000000 80000000 00000000 00000000 00000200 00020002 00002000 00000400 |