On Target AGTR2_HUMAN 0.33333334/CHEMBL155987
For the given ligand mescaline, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL155987. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL155987 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc2c(cc1OCc1ccccc1)CC(C(=O)O)N(C(=O)C(c1ccccc1)c1ccccc1)C2 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04008008 46805008 20100108 10210600 000010a0 c0004000 03041000 03001004 00000980 00080840 08300000 4000b000 0780c882 20210080 c1080481 02088008 10000200 02000020 00480008 00020201 80020100 18208e20 03004040 81c49018 00000800 e0002001 00324000 c0000000 04000380 0086000b 60046000 00002600 |