On Target NOS2_HUMAN 0.38/CHEMBL1762476
For the given ligand mescaline, we have found in our database that, being scored 0.38, the most similar ligand is CHEMBL1762476. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL1762476 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | CNCC[C@@H](Oc1cc(OC)ccc1C#N)c1ccccc1.O=C(O)C(=O)O |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04000005 00000208 20100108 00010600 00001020 02004000 42040000 00000000 04000900 008808c0 08300000 4000c000 00808002 00010000 01000001 020c2008 00600000 22008004 00800000 00022801 40000100 18000a20 05000480 00c01010 00004000 80002000 00020000 10000000 00010300 0006042a 40000000 00000640 |