On Target AA2AR_HUMAN 0.3655914/CHEMBL166424
For the given ligand mescaline, we have found in our database that, being scored 0.3655914, the most similar ligand is CHEMBL166424. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL166424 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(/C=N/N=C(\S)Cc2ccccc2)c(O)c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00880001 00000008 20000108 00110200 04405000 00000000 42040004 01000000 00000100 01090841 a8010000 40008000 80000002 08040300 01800001 00082008 00000000 02000000 00000400 40220800 00000000 08000010 40001802 02400011 00010000 80002800 40020000 00000000 00000208 000e0002 40000000 01011400 |