On Target PGH2_HUMAN 0.4923077/CHEMBL83527
For the given ligand mescaline, we have found in our database that, being scored 0.4923077, the most similar ligand is CHEMBL83527. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL83527 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000001 40000008 20000108 00010200 00001000 00000000 c2000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 01000003 00000008 00000400 02000004 00080000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400200 00020100 04000000 00000100 |