On Target GLRA3_HUMAN 0.2/CHEMBL4070615
For the given ligand mescaline, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | C[C@H]1[C@H]2C(=O)N(C)c3ccncc3[C@H]2CN1S(=O)(=O)c1ccc2c(c1)OCO2 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |