On Target NTRK1_HUMAN 0.3904762/CHEMBL261849
For the given ligand mescaline, we have found in our database that, being scored 0.3904762, the most similar ligand is CHEMBL261849. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL261849 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc(COc2ccc(Cc3cnc(N)nc3N)cc2OC)cc1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 0c000002 42000008 20000188 08290610 02001008 00084000 0204a000 01000800 00400100 00080840 28000004 4000b000 00804002 20010000 01020001 020c800c 00010000 02000001 00480000 40220200 00000000 0c000420 20800840 00c21010 00040000 80002000 00520000 40000000 00000288 0046000a 40000000 200004c0 |