On Target MTOR_HUMAN 0.45054945/CHEMBL4214825
For the given ligand mescaline, we have found in our database that, being scored 0.45054945, the most similar ligand is CHEMBL4214825. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL4214825 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc(O)c(C(=O)C#Cc2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000201 40020808 20000909 02091200 00403010 40020000 42040000 00000200 00000000 00080840 08800000 40008008 0008c002 00001001 01000001 0000a008 00000000 02000404 00080000 00021a00 00000000 08820200 00000001 02400017 00000044 c0000002 00120800 00000000 00000300 0002400a 80000800 00100400 |