On Target OPRX_HUMAN 0.42696628/CHEMBL448155
For the given ligand mescaline, we have found in our database that, being scored 0.42696628, the most similar ligand is CHEMBL448155. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL448155 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000000 01000008 2010010a 00010600 00001000 00000000 02040000 23001000 00300880 000908c0 08300000 40038000 00000802 00200000 01000401 00000008 00000000 02000000 00000000 00020201 00000100 38208000 00000000 83500010 00000000 e0000000 00320000 d0000000 0c000380 00060002 20040000 00000600 |