On Target FYN_HUMAN 0.36263737/CHEMBL221753
For the given ligand mescaline, we have found in our database that, being scored 0.36263737, the most similar ligand is CHEMBL221753. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL221753 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1.[Cl-] |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04000008 01000008 2000010a 80010600 00001080 00000000 02040000 02001040 00002800 00080840 08300000 40008000 00800802 00200000 01201409 00090008 10000000 02000000 00000002 00020001 00000100 08008000 16000000 08400010 00000400 c0000000 00120000 80800021 00000300 00060002 00040000 00020600 |