On Target PTGES_HUMAN 0.38135594/CHEMBL3753433
For the given ligand mescaline, we have found in our database that, being scored 0.38135594, the most similar ligand is CHEMBL3753433. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL3753433 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc([C@@H]2Oc3c(OC)cc(/C=C/c4cc(OC)c(OC)c(OC)c4)cc3[C@H]2c2cc(OC)c(OC)c(OC)c2)ccc1O |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 04001001 4a000008 20000108 00210200 00001041 c2004000 c2040080 01000640 00000900 00080848 08100100 40108240 00804002 20010000 01040007 0208a018 48000400 02008004 04480000 00020a01 00000100 18100020 01000001 02c21010 00004000 e0002000 00522008 40000004 00404380 0022010a 46000000 00000540 |