On Target HRH1_HUMAN 0.4494382/CHEMBL482496
For the given ligand mescaline, we have found in our database that, being scored 0.4494382, the most similar ligand is CHEMBL482496. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL482496 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | [3H]C([3H])([3H])Oc1cc(I)c(OC)cc1CCNCc1ccccc1OC([3H])([3H])[3H] |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000000 42000008 a0300108 00010600 00001000 80000108 02000000 02001600 00000080 00180840 08200000 40008080 00000842 22002000 01000401 00002048 90000000 02000000 00080100 00020200 00010040 18208000 00008000 81400010 00000000 c0000000 00480000 80000000 04000300 00060002 24240000 02000600 |