On Target IKKB_HUMAN 0.4021739/CHEMBL3125821
For the given ligand mescaline, we have found in our database that, being scored 0.4021739, the most similar ligand is CHEMBL3125821. Check out the elaboration below.
| mescaline (Given Ligand) | CHEMBL3125821 (Similar Ligand) |
|---|---|
| COc1cc(CCN)cc(OC)c1OC | COc1cc(/C=C/C(=O)c2cc(OC)ccc2O)cc(OC)c1 |
|
|
|
|
|
|
| 00000001 42000008 20000108 00010600 00001000 80000000 42040000 00000000 00000000 00080840 08000000 40008000 00004002 20000000 01000001 00008008 00000000 02000004 00080000 00020a00 00000000 18000000 00000000 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00000400 | 00000001 42000c08 20000308 00010202 00001000 00820000 c2000081 00000600 01840000 00b80840 08000000 40108000 00008002 20000000 01004003 20002008 00000400 02100004 00098000 00020a00 00000000 08020200 00008000 00400014 01000000 80000000 00482000 40000000 00400200 00020102 84000000 02000500 |