On Target NMDZ1_HUMAN 0.10743801/CHEMBL162675
For the given ligand fff, we have found in our database that, being scored 0.10743801, the most similar ligand is CHEMBL162675. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL162675 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | C[C@@H](NCc1cc(F)cc2nc(O)c(O)nc12)P(=O)(O)O |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 10010012 02000e18 40100102 02010610 00040040 00c00034 0400c000 02601000 00000080 00202840 01200004 50008000 80000802 00421000 60840568 0004800d 08022028 02000000 00200000 00000000 40020020 0d308800 21800080 00400000 01044400 c4000005 08008040 80016007 01000100 20078000 00048000 84008223 |