On Target PDE5A_HUMAN 0.11818182/CHEMBL545749
For the given ligand fff, we have found in our database that, being scored 0.11818182, the most similar ligand is CHEMBL545749. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL545749 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Cl.Fc1ccc2nc(-c3cccnc3)nc(NCc3ccccc3)c2c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00014002 00010000 80104100 1a090610 01041020 00004030 00009000 02081800 10000100 10000840 01202004 4000d010 04000800 00501000 00020040 020c0005 00040000 02007004 08600000 00600004 40100000 0804a028 20814040 00400010 00040002 80000080 08000000 800000a1 0040810c 00468400 40041800 200202c0 |