On Target COMT_HUMAN 0.15853658/CHEMBL4171117
For the given ligand fff, we have found in our database that, being scored 0.15853658, the most similar ligand is CHEMBL4171117. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL4171117 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=S(=O)(c1ccc(F)cc1)c1cc(F)c(O)c2ncccc12 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000042 0180c208 60124000 02900200 00040000 00080014 02010800 00200000 00000000 00200840 20002004 20008000 00000803 00401000 80200448 0004000c 04001808 00000000 00200400 00022000 d0000000 08008008 20800000 98000019 01000400 00000000 00000000 00800083 00000200 00038000 00040000 00010220 |