On Target TRPV1_RAT 0.24528302/CHEMBL1779671
For the given ligand fff, we have found in our database that, being scored 0.24528302, the most similar ligand is CHEMBL1779671. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL1779671 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=C(Nc1cccc(F)c1)Nc1cccc2ccc(O)cc12 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000006 00000008 20100000 02000a40 00000100 00000010 02000000 00002001 08000000 00004840 00280004 20008000 00018022 00101000 00000040 00000008 00040000 00000000 08000000 00020000 40000100 08000408 20022000 00000000 00100000 00000000 00040000 00000081 00008000 00068001 00000000 00004200 |