On Target FABP5_HUMAN 0.10619469/CHEMBL4643718
For the given ligand fff, we have found in our database that, being scored 0.10619469, the most similar ligand is CHEMBL4643718. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL4643718 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=C(O)c1ccccc1Nc1cccc(Cl)c1-c1ccc2nonc2c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 0088a002 20000800 10100100 02010200 00840000 00034010 08000010 04080840 00842100 00400840 00200104 70009800 06018004 00481001 00020040 000c000c 00060000 0e002004 0c20800a 00104002 41000020 18020b20 31801000 0040800c 00002000 80000200 02000040 000010c3 0000c000 00268000 c0000800 00020020 |