On Target PAR1_HUMAN 0.17567568/CHEMBL1729550
For the given ligand fff, we have found in our database that, being scored 0.17567568, the most similar ligand is CHEMBL1729550. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL1729550 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CCCC(=O)Nc1cccc(NC(=O)c2ccccc2F)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00004002 00000800 00100100 02010600 28000000 00002010 00000800 02001000 00000000 000008c0 00280004 4000d000 04008840 00101000 00020040 00000000 02040200 02000000 08000000 04000001 40100000 18028600 20012000 20400014 00080000 80100000 00000400 90000081 00808100 00068001 80040000 00000200 |