On Target HYES_HUMAN 0.21666667/CHEMBL243522
For the given ligand fff, we have found in our database that, being scored 0.21666667, the most similar ligand is CHEMBL243522. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL243522 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=C(NC1CCC(Cc2ccc(F)cc2)CC1)NC12CC3CC(CC(C3)C1)C2 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 01001000 00100102 02010e00 00000000 00000010 00000004 00002000 00000800 000808c0 08300000 40018000 00009000 00201000 00000000 00000000 00000000 02000080 02002040 00100001 00000100 18050410 00000000 00500018 00010000 80000000 00000000 10000001 00000002 00068003 000a0000 00000600 |