On Target AOFA_HUMAN 0.23636363/CHEMBL3415798
For the given ligand fff, we have found in our database that, being scored 0.23636363, the most similar ligand is CHEMBL3415798. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3415798 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | C#CCN(C)CC(=C)c1ccc(F)cc1.Cl |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 00000000 00100100 02010600 00402000 00000010 80000080 00100400 00000080 00080840 08200000 40008000 00000002 00011000 00180000 00000000 00000000 02000180 00000000 00100200 00000000 18200000 00010000 81400010 00000000 80000000 00082000 00020001 04400000 00068002 04000020 00020600 |