On Target ADRB2_HUMAN 0.16666667/CHEMBL3290995
For the given ligand fff, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL3290995. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3290995 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | OCc1cc(C(O)CNCCc2ccc(Nc3ccc(F)cc3)cc2)ccc1O |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000002 00000808 20100100 42010600 01001081 00004010 02000010 00000800 00002180 00080840 a8200004 40008000 00000002 00009000 00080040 00082008 10040000 02000000 08000002 40220200 40000000 18200020 22000000 81400010 00000000 80000000 02520000 00000081 04008000 00068002 40000000 00002600 |