On Target PPARG_HUMAN 0.18055555/CHEMBL206794
For the given ligand fff, we have found in our database that, being scored 0.18055555, the most similar ligand is CHEMBL206794. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL206794 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C)(Oc1ccc(OCCCOc2ccc(Oc3ccc(F)cc3)cc2Cl)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 04008000 00020008 20100008 02410200 00001000 02000010 92000000 00000000 00000000 01000840 00040000 4000d800 02808006 00001002 01200001 00082008 00000000 80000000 01802000 00420000 00400000 18000b00 05001000 0a000010 00002000 00008800 00080008 00a00001 00000200 00028000 00000400 02020200 |