On Target PPAP_HUMAN 0.10606061/CHEMBL498632
For the given ligand fff, we have found in our database that, being scored 0.10606061, the most similar ligand is CHEMBL498632. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL498632 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=P(O)(O)C(NCc1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00000840 00200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400000 00000000 c6010006 00000000 80014000 00000100 30060000 00040000 00008203 |