On Target CHLE_HUMAN 0.17567568/CHEMBL229105
For the given ligand fff, we have found in our database that, being scored 0.17567568, the most similar ligand is CHEMBL229105. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL229105 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=C(OCCCCN1CCC(OCc2ccccc2)CC1)c1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 01000800 00100100 02010700 00100010 00004010 00000000 20000000 00000100 000008c0 00200000 50018000 00008002 00091000 00200000 02081008 00220000 02000200 00c00000 00100201 00000020 18020a20 01000080 00500014 00000401 80002000 00080200 10000001 00000200 00068002 c0000000 02002a00 |