On Target NEP_HUMAN 0.17105263/CHEMBL11297
For the given ligand fff, we have found in our database that, being scored 0.17105263, the most similar ligand is CHEMBL11297. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL11297 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(NC(=O)C(CS)C(C)c1ccc(F)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 00004200 00100100 02110600 00000080 00000010 00000000 20000000 00000800 000808c0 08300000 4000b000 06008002 00041000 80080000 000c0008 10000000 02000080 00000008 00500201 60000100 18000e00 03000300 00400018 00000800 80000000 00000000 10000001 00000000 0006803b 20004000 01010600 |