On Target HPGDS_HUMAN 0.16049382/CHEMBL3925567
For the given ligand fff, we have found in our database that, being scored 0.16049382, the most similar ligand is CHEMBL3925567. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3925567 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Fc1cccc(-c2ncc(-c3cnc(-c4ccccc4)nc3)[nH]2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00010002 00010000 00100100 12010610 00000060 00004010 00001000 00080040 00000100 10002850 00008004 50008810 02010000 00181000 00020001 000c0004 00000000 02002000 00400000 40400000 01000000 28000000 21802040 00400000 00840003 80000000 00002200 00001041 00030004 00668c00 40000820 10000280 |