On Target ALDR_HUMAN 0.15116279/CHEMBL425922
For the given ligand fff, we have found in our database that, being scored 0.15116279, the most similar ligand is CHEMBL425922. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL425922 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=S(=O)(c1ccc(F)cc1)c1ccc(O)nn1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000002 0080c318 20120020 02900200 000c0000 00000010 00000800 00000000 00000200 00000840 20002004 30008000 10000006 00001000 80680000 0004001c 04001000 00000800 00200410 00227081 80040800 0c201000 20800800 08000009 00104000 080000c0 00000000 04000081 00200200 00068000 08000000 00010264 |