On Target AA1R_HUMAN 0.15476191/CHEMBL3903115
For the given ligand fff, we have found in our database that, being scored 0.15476191, the most similar ligand is CHEMBL3903115. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3903115 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Nc1ncc(-c2ccc(F)cc2)c(-c2ccccc2)n1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 0000a002 00000801 80100180 02050610 01800004 00004018 00002000 00080000 00000100 00000840 00000084 60008800 02000000 00301000 20020000 800c0004 00020000 02002000 04400000 40300000 00000000 0c020000 30802840 00400108 00040001 80080000 00000200 00000061 0001400c 00468001 40000800 000002a0 |