On Target PGH1_SHEEP 0.25/CHEMBL563
For the given ligand fff, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL563. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL563 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 |