On Target CNR1_HUMAN 0.18571429/CHEMBL4078901
For the given ligand fff, we have found in our database that, being scored 0.18571429, the most similar ligand is CHEMBL4078901. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL4078901 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2ccc(F)cc2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 0000a006 00000000 00100100 02010a40 04800000 00000010 00000000 00002001 00000000 00000850 00280004 40008800 03008004 08101000 00000040 00000000 00060000 02000000 0c000000 00100000 40000100 08000500 30022000 00400000 00142000 80080000 00080200 000000c1 0040c000 00068001 00000000 02024200 |