On Target NMDE2_HUMAN 0.22413793/CHEMBL159879
For the given ligand fff, we have found in our database that, being scored 0.22413793, the most similar ligand is CHEMBL159879. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL159879 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | N=C(NCc1cccc(Cl)c1)c1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00008000 08000000 00100100 02010600 00000000 00000010 04000000 02001000 00000100 0000085b 00200000 40008800 02000806 00001000 80100400 00180000 00002000 02000100 00000000 00100000 00000000 08008100 00000000 00400000 00002000 c0000000 40000000 90000001 00000118 00068000 40040000 00020200 |